C26H28N4O7S — CID 43879345
2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide (PubChem CID 43879345) has the molecular formula C26H28N4O7S and a molecular weight of 540.60 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43879345 |
| Molecular Formula | C26H28N4O7S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C/c2ccc(C(C)C)cc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C26H28N4O7S/c1-18(2)20-11-9-19(10-12-20)16-27-28-26(31)17-29(22-14-13-21(36-3)15-24(22)37-4)38(34,35)25-8-6-5-7-23(25)30(32)33/h5-16,18H,17H2,1-4H3,(H,28,31)/b27-16+ |
| InChIKey | VOSLPTKRGJEZIU-JVWAILMASA-N |
| XLogP | 4.08 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|