C23H21ClN4O7S — CID 43879319
N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 43879319) has the molecular formula C23H21ClN4O7S and a molecular weight of 532.96 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43879319 |
| Molecular Formula | C23H21ClN4O7S |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C/c2cccc(Cl)c2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C23H21ClN4O7S/c1-34-18-10-11-19(21(13-18)35-2)27(36(32,33)22-9-4-3-8-20(22)28(30)31)15-23(29)26-25-14-16-6-5-7-17(24)12-16/h3-14H,15H2,1-2H3,(H,26,29)/b25-14+ |
| InChIKey | ZZYPWMRYPAPBOF-AFUMVMLFSA-N |
| XLogP | 3.61 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|