C34H36N6O14S2 — CID 43891797
2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]ethyl]acetamide (PubChem CID 43891797) has the molecular formula C34H36N6O14S2 and a molecular weight of 816.82 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]ethyl]acetamide.
| Compound Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 43891797 |
| Molecular Formula | C34H36N6O14S2 |
| Molecular Weight | 816.82 g/mol |
| Exact Mass | 816.17 |
| IUPAC Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-[2-[[2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]ethyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCNC(=O)CN(c2ccc(OC)cc2OC)S(=O)(=O)c2ccccc2[N+](=O)[O-])S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C34H36N6O14S2/c1-51-23-13-15-25(29(19-23)53-3)37(55(47,48)31-11-7-5-9-27(31)39(43)44)21-33(41)35-17-18-36-34(42)22-38(26-16-14-24(52-2)20-30(26)54-4)56(49,50)32-12-8-6-10-28(32)40(45)46/h5-16,19-20H,17-18,21-22H2,1-4H3,(H,35,41)(H,36,42) |
| InChIKey | DBKVEGSKKLPTFZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 256.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|