C22H29N3O7S2 — CID 3467263
N-(2-tert-butylsulfanylethyl)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 3467263) has the molecular formula C22H29N3O7S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3467263 |
| Molecular Formula | C22H29N3O7S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSC(C)(C)C)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H29N3O7S2/c1-22(2,3)33-13-12-23-21(26)15-24(17-11-10-16(31-4)14-19(17)32-5)34(29,30)20-9-7-6-8-18(20)25(27)28/h6-11,14H,12-13,15H2,1-5H3,(H,23,26) |
| InChIKey | CWFRDGUOPIRLSE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|