C20H25N3O7S — CID 40631968
N-[(2R)-butan-2-yl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 40631968) has the molecular formula C20H25N3O7S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 40631968 |
| Molecular Formula | C20H25N3O7S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | CC[C@@H](C)NC(=O)CN(c1ccc(OC)cc1OC)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N3O7S/c1-5-14(2)21-20(24)13-22(16-11-10-15(29-3)12-18(16)30-4)31(27,28)19-9-7-6-8-17(19)23(25)26/h6-12,14H,5,13H2,1-4H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | RZVGUUHYPNMMRN-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|