C21H21N3O8S — CID 1117129
2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 1117129) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1117129 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCc2ccco2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C21H21N3O8S/c1-30-15-9-10-17(19(12-15)31-2)23(14-21(25)22-13-16-6-5-11-32-16)33(28,29)20-8-4-3-7-18(20)24(26)27/h3-12H,13-14H2,1-2H3,(H,22,25) |
| InChIKey | BUQYPYPAYNTAQD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|