C25H26ClN3O7S2 — CID 51345118
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 51345118) has the molecular formula C25H26ClN3O7S2 and a molecular weight of 580.08 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 51345118 |
| Molecular Formula | C25H26ClN3O7S2 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSCc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C25H26ClN3O7S2/c1-35-20-11-12-21(23(15-20)36-2)28(38(33,34)24-6-4-3-5-22(24)29(31)32)16-25(30)27-13-14-37-17-18-7-9-19(26)10-8-18/h3-12,15H,13-14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | PNGITTIAHSHICI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|