C23H22ClN3O5S2 — CID 51345091
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 51345091) has the molecular formula C23H22ClN3O5S2 and a molecular weight of 520.03 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 51345091 |
| Molecular Formula | C23H22ClN3O5S2 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O5S2/c24-19-12-10-18(11-13-19)17-33-15-14-25-23(28)16-26(20-6-2-1-3-7-20)34(31,32)22-9-5-4-8-21(22)27(29)30/h1-13H,14-17H2,(H,25,28) |
| InChIKey | DXRGSJJXUROTPZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|