C25H25ClN2O5S2 — CID 126195643
2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 126195643) has the molecular formula C25H25ClN2O5S2 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 126195643 |
| Molecular Formula | C25H25ClN2O5S2 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1ccc2c(c1)OCCO2)S(=O)(=O)c1ccccc1)NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN2O5S2/c26-20-8-6-19(7-9-20)18-34-15-12-27-25(29)17-28(35(30,31)22-4-2-1-3-5-22)21-10-11-23-24(16-21)33-14-13-32-23/h1-11,16H,12-15,17-18H2,(H,27,29) |
| InChIKey | KRTYCRSOZWWSTK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|