C24H24Cl2N2O3S2 — CID 51343696
2-[N-(benzenesulfonyl)-3-chloro-2-methylanilino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 51343696) has the molecular formula C24H24Cl2N2O3S2 and a molecular weight of 523.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-2-methylanilino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-2-methylanilino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 51343696 |
| Molecular Formula | C24H24Cl2N2O3S2 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-2-methylanilino]-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1c(Cl)cccc1N(CC(=O)NCCSCc1ccc(Cl)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24Cl2N2O3S2/c1-18-22(26)8-5-9-23(18)28(33(30,31)21-6-3-2-4-7-21)16-24(29)27-14-15-32-17-19-10-12-20(25)13-11-19/h2-13H,14-17H2,1H3,(H,27,29) |
| InChIKey | MNECIUMEEPSYNU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|