C25H32N2O5S2 — CID 30252112
2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(3-cyclohexylsulfanylpropyl)acetamide (PubChem CID 30252112) has the molecular formula C25H32N2O5S2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(3-cyclohexylsulfanylpropyl)acetamide.
| Compound Name | 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30252112 |
| Molecular Formula | C25H32N2O5S2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
| SMILES | O=C(CN(c1ccc2c(c1)OCCO2)S(=O)(=O)c1ccccc1)NCCCSC1CCCCC1 |
| InChI | InChI=1S/C25H32N2O5S2/c28-25(26-14-7-17-33-21-8-3-1-4-9-21)19-27(34(29,30)22-10-5-2-6-11-22)20-12-13-23-24(18-20)32-16-15-31-23/h2,5-6,10-13,18,21H,1,3-4,7-9,14-17,19H2,(H,26,28) |
| InChIKey | IVKMZBRVMLTACV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|