C23H29ClN2O3S2 — CID 30200870
2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide (PubChem CID 30200870) has the molecular formula C23H29ClN2O3S2 and a molecular weight of 481.08 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30200870 |
| Molecular Formula | C23H29ClN2O3S2 |
| Molecular Weight | 481.08 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1)S(=O)(=O)c1ccccc1)NCCCSC1CCCCC1 |
| InChI | InChI=1S/C23H29ClN2O3S2/c24-19-9-7-10-20(17-19)26(31(28,29)22-13-5-2-6-14-22)18-23(27)25-15-8-16-30-21-11-3-1-4-12-21/h2,5-7,9-10,13-14,17,21H,1,3-4,8,11-12,15-16,18H2,(H,25,27) |
| InChIKey | FKIHIOSKQFLQPT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.08 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|