C23H28Cl2N2O4S — CID 30205047
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-cyclohexyloxypropyl)acetamide (PubChem CID 30205047) has the molecular formula C23H28Cl2N2O4S and a molecular weight of 499.46 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-cyclohexyloxypropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-cyclohexyloxypropyl)acetamide |
|---|---|
| PubChem CID | 30205047 |
| Molecular Formula | C23H28Cl2N2O4S |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(3-cyclohexyloxypropyl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C23H28Cl2N2O4S/c24-18-14-19(25)16-20(15-18)27(32(29,30)22-10-5-2-6-11-22)17-23(28)26-12-7-13-31-21-8-3-1-4-9-21/h2,5-6,10-11,14-16,21H,1,3-4,7-9,12-13,17H2,(H,26,28) |
| InChIKey | GIZUPKIKIKQBEG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|