C23H30N2O4S — CID 30174863
2-[N-(benzenesulfonyl)-3-methylanilino]-N-(3-cyclopentyloxypropyl)acetamide (PubChem CID 30174863) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methylanilino]-N-(3-cyclopentyloxypropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methylanilino]-N-(3-cyclopentyloxypropyl)acetamide |
|---|---|
| PubChem CID | 30174863 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methylanilino]-N-(3-cyclopentyloxypropyl)acetamide |
| SMILES | Cc1cccc(N(CC(=O)NCCCOC2CCCC2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-19-9-7-10-20(17-19)25(30(27,28)22-13-3-2-4-14-22)18-23(26)24-15-8-16-29-21-11-5-6-12-21/h2-4,7,9-10,13-14,17,21H,5-6,8,11-12,15-16,18H2,1H3,(H,24,26) |
| InChIKey | DWWQXBOTSQPXDP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|