C27H38N2O3S2 — CID 30213324
N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetamide (PubChem CID 30213324) has the molecular formula C27H38N2O3S2 and a molecular weight of 502.75 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 30213324 |
| Molecular Formula | C27H38N2O3S2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCSC2CCCCC2)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H38N2O3S2/c1-21(2)23-12-14-24(15-13-23)29(34(31,32)26-16-10-22(3)11-17-26)20-27(30)28-18-7-19-33-25-8-5-4-6-9-25/h10-17,21,25H,4-9,18-20H2,1-3H3,(H,28,30) |
| InChIKey | WFLKKAPMPAPWHV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|