C26H36N2O4S2 — CID 30216269
N-(3-cyclohexylsulfanylpropyl)-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 30216269) has the molecular formula C26H36N2O4S2 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30216269 |
| Molecular Formula | C26H36N2O4S2 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(C)cc1N(CC(=O)NCCCSC1CCCCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H36N2O4S2/c1-20-10-13-23(14-11-20)34(30,31)28(24-18-21(2)12-15-25(24)32-3)19-26(29)27-16-7-17-33-22-8-5-4-6-9-22/h10-15,18,22H,4-9,16-17,19H2,1-3H3,(H,27,29) |
| InChIKey | IOYWZZQJVXURSB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|