C24H32N2O4S2 — CID 30202134
2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide (PubChem CID 30202134) has the molecular formula C24H32N2O4S2 and a molecular weight of 476.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30202134 |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
| SMILES | COc1cccc(N(CC(=O)NCCCSC2CCCCC2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H32N2O4S2/c1-30-21-11-8-10-20(18-21)26(32(28,29)23-14-6-3-7-15-23)19-24(27)25-16-9-17-31-22-12-4-2-5-13-22/h3,6-8,10-11,14-15,18,22H,2,4-5,9,12-13,16-17,19H2,1H3,(H,25,27) |
| InChIKey | HEYBCIOIOWXIPX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|