C25H34N2O5S2 — CID 30204081
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide (PubChem CID 30204081) has the molecular formula C25H34N2O5S2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30204081 |
| Molecular Formula | C25H34N2O5S2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(3-cyclohexylsulfanylpropyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCCSC2CCCCC2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H34N2O5S2/c1-31-20-14-15-24(32-2)23(18-20)27(34(29,30)22-12-7-4-8-13-22)19-25(28)26-16-9-17-33-21-10-5-3-6-11-21/h4,7-8,12-15,18,21H,3,5-6,9-11,16-17,19H2,1-2H3,(H,26,28) |
| InChIKey | IELXCDRLMKKGSX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|