C22H28N2O5S — CID 1100043
2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-cyclohexylacetamide (PubChem CID 1100043) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-cyclohexylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 1100043 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-cyclohexylacetamide |
| SMILES | COc1ccc(N(CC(=O)NC2CCCCC2)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O5S/c1-28-18-13-14-20(21(15-18)29-2)24(30(26,27)19-11-7-4-8-12-19)16-22(25)23-17-9-5-3-6-10-17/h4,7-8,11-15,17H,3,5-6,9-10,16H2,1-2H3,(H,23,25) |
| InChIKey | JLRNHEQLOWBMFS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |