C24H26N2O6S — CID 5234428
2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-(2-phenoxyethyl)acetamide (PubChem CID 5234428) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 5234428 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-(2-phenoxyethyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCOc2ccccc2)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O6S/c1-30-20-13-14-22(23(17-20)31-2)26(33(28,29)21-11-7-4-8-12-21)18-24(27)25-15-16-32-19-9-5-3-6-10-19/h3-14,17H,15-16,18H2,1-2H3,(H,25,27) |
| InChIKey | INASVPSLBDMWPA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|