C15H24N2O6S — CID 2890925
2-(2,4-dimethoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 2890925) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2,4-dimethoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 2890925 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(2,4-dimethoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(c1ccc(OC)cc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O6S/c1-21-9-5-8-16-15(18)11-17(24(4,19)20)13-7-6-12(22-2)10-14(13)23-3/h6-7,10H,5,8-9,11H2,1-4H3,(H,16,18) |
| InChIKey | AEAIXGWZEZIIDJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|