C22H29N3O5S — CID 6303075
2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide (PubChem CID 6303075) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 6303075 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C(/C)C(C)(C)C)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-16(22(2,3)4)23-24-21(26)15-25(31(27,28)18-10-8-7-9-11-18)19-13-12-17(29-5)14-20(19)30-6/h7-14H,15H2,1-6H3,(H,24,26)/b23-16- |
| InChIKey | KYMYHCGHLCKQLK-KQWNVCNZSA-N |
| XLogP | 3.44 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|