C28H33N3O5S — CID 126191532
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide (PubChem CID 126191532) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 126191532 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C(/C)CC(C)(C)c2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H33N3O5S/c1-21(19-28(2,3)22-12-8-6-9-13-22)29-30-27(32)20-31(37(33,34)24-14-10-7-11-15-24)25-18-23(35-4)16-17-26(25)36-5/h6-18H,19-20H2,1-5H3,(H,30,32)/b29-21- |
| InChIKey | VOPYZBXCNNVXCQ-ANYBSYGZSA-N |
| XLogP | 4.76 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|