C24H33N3O6S — CID 126034944
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide (PubChem CID 126034944) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 126034944 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C(/C)C(C)(C)C)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H33N3O6S/c1-8-33-19-11-9-18(10-12-19)27(16-23(28)26-25-17(2)24(3,4)5)34(29,30)20-13-14-21(31-6)22(15-20)32-7/h9-15H,8,16H2,1-7H3,(H,26,28)/b25-17- |
| InChIKey | OIGFBYBDHGPDGW-UQQQWYQISA-N |
| XLogP | 3.84 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|