C19H23NO7S — CID 1311116
methyl 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetate (PubChem CID 1311116) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetate.
| Compound Name | methyl 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetate |
|---|---|
| PubChem CID | 1311116 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | methyl 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetate |
| SMILES | CCOc1ccc(N(CC(=O)OC)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO7S/c1-5-27-15-8-6-14(7-9-15)20(13-19(21)26-4)28(22,23)16-10-11-17(24-2)18(12-16)25-3/h6-12H,5,13H2,1-4H3 |
| InChIKey | SPFDCVOJPDFBCB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |