C28H39N3O6S — CID 126035261
N-[(4-tert-butylcyclohexylidene)amino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126035261) has the molecular formula C28H39N3O6S and a molecular weight of 545.70 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126035261 |
| Molecular Formula | C28H39N3O6S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NN=C2CCC(C(C)(C)C)CC2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H39N3O6S/c1-7-37-23-14-12-22(13-15-23)31(38(33,34)24-16-17-25(35-5)26(18-24)36-6)19-27(32)30-29-21-10-8-20(9-11-21)28(2,3)4/h12-18,20H,7-11,19H2,1-6H3,(H,30,32)/b29-21- |
| InChIKey | UMDMYVFCZMNROQ-ANYBSYGZSA-N |
| XLogP | 5.01 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|