C21H33N3O5S — CID 3983362
N-[(4-tert-butylcyclohexylidene)amino]-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 3983362) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3983362 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NN=C2CCC(C(C)(C)C)CC2)S(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C21H33N3O5S/c1-21(2,3)15-7-9-16(10-8-15)22-23-20(25)14-24(30(6,26)27)18-12-11-17(28-4)13-19(18)29-5/h11-13,15H,7-10,14H2,1-6H3,(H,23,25)/b22-16- |
| InChIKey | PUHWWXXKXAEDEA-JWGURIENSA-N |
| XLogP | 3.18 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|