C22H28BrN3O4S — CID 5195720
2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(3,3-dimethylbutan-2-ylideneamino)acetamide (PubChem CID 5195720) has the molecular formula C22H28BrN3O4S and a molecular weight of 510.45 g/mol. Its IUPAC name is 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(3,3-dimethylbutan-2-ylideneamino)acetamide.
| Compound Name | 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(3,3-dimethylbutan-2-ylideneamino)acetamide |
|---|---|
| PubChem CID | 5195720 |
| Molecular Formula | C22H28BrN3O4S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(3,3-dimethylbutan-2-ylideneamino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NN=C(C)C(C)(C)C)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H28BrN3O4S/c1-6-30-19-11-9-18(10-12-19)26(15-21(27)25-24-16(2)22(3,4)5)31(28,29)20-13-7-17(23)8-14-20/h7-14H,6,15H2,1-5H3,(H,25,27) |
| InChIKey | FNDBDNLATOBNDR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|