C24H31FN2O3S2 — CID 30227424
N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 30227424) has the molecular formula C24H31FN2O3S2 and a molecular weight of 478.66 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 30227424 |
| Molecular Formula | C24H31FN2O3S2 |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCCCSC2CCCCC2)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H31FN2O3S2/c1-19-8-12-21(13-9-19)27(32(29,30)23-14-10-20(25)11-15-23)18-24(28)26-16-5-17-31-22-6-3-2-4-7-22/h8-15,22H,2-7,16-18H2,1H3,(H,26,28) |
| InChIKey | VCGMFKJPPHMTBU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|