C25H30N2O5S2 — CID 30216270
N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 30216270) has the molecular formula C25H30N2O5S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30216270 |
| Molecular Formula | C25H30N2O5S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(2-methoxy-5-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(C)cc1N(CC(=O)NCCCSCc1ccco1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H30N2O5S2/c1-19-7-10-22(11-8-19)34(29,30)27(23-16-20(2)9-12-24(23)31-3)17-25(28)26-13-5-15-33-18-21-6-4-14-32-21/h4,6-12,14,16H,5,13,15,17-18H2,1-3H3,(H,26,28) |
| InChIKey | HQPYEQNNJBWPLE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|