C25H30N2O4S2 — CID 30212767
2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30212767) has the molecular formula C25H30N2O4S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30212767 |
| Molecular Formula | C25H30N2O4S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-(3,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2ccco2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C25H30N2O4S2/c1-19-7-11-24(12-8-19)33(29,30)27(22-10-9-20(2)21(3)16-22)17-25(28)26-13-5-15-32-18-23-6-4-14-31-23/h4,6-12,14,16H,5,13,15,17-18H2,1-3H3,(H,26,28) |
| InChIKey | PUXMMEXIIAZSJG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|