C24H28N2O4S2 — CID 30176489
2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30176489) has the molecular formula C24H28N2O4S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30176489 |
| Molecular Formula | C24H28N2O4S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCCCSCc2ccco2)S(=O)(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C24H28N2O4S2/c1-19-11-12-21(16-20(19)2)26(32(28,29)23-9-4-3-5-10-23)17-24(27)25-13-7-15-31-18-22-8-6-14-30-22/h3-6,8-12,14,16H,7,13,15,17-18H2,1-2H3,(H,25,27) |
| InChIKey | AGYVWDBOXLDCSS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|