C23H25ClN2O5S2 — CID 30206008
2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30206008) has the molecular formula C23H25ClN2O5S2 and a molecular weight of 509.05 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30206008 |
| Molecular Formula | C23H25ClN2O5S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCCCSCc1ccco1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25ClN2O5S2/c1-30-22-11-10-18(24)15-21(22)26(33(28,29)20-8-3-2-4-9-20)16-23(27)25-12-6-14-32-17-19-7-5-13-31-19/h2-5,7-11,13,15H,6,12,14,16-17H2,1H3,(H,25,27) |
| InChIKey | SIHBLLXGEHFSIZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|