C18H23ClN2O4S2 — CID 30222838
2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30222838) has the molecular formula C18H23ClN2O4S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30222838 |
| Molecular Formula | C18H23ClN2O4S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | Cc1ccc(Cl)cc1N(CC(=O)NCCCSCc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C18H23ClN2O4S2/c1-14-6-7-15(19)11-17(14)21(27(2,23)24)12-18(22)20-8-4-10-26-13-16-5-3-9-25-16/h3,5-7,9,11H,4,8,10,12-13H2,1-2H3,(H,20,22) |
| InChIKey | KLSFNKOAROJWCX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|