C17H20ClFN2O4S2 — CID 30245927
2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide (PubChem CID 30245927) has the molecular formula C17H20ClFN2O4S2 and a molecular weight of 434.94 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide.
| Compound Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
|---|---|
| PubChem CID | 30245927 |
| Molecular Formula | C17H20ClFN2O4S2 |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-(3-chloro-4-fluoro-N-methylsulfonylanilino)-N-[3-(furan-2-ylmethylsulfanyl)propyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccco1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClFN2O4S2/c1-27(23,24)21(13-5-6-16(19)15(18)10-13)11-17(22)20-7-3-9-26-12-14-4-2-8-25-14/h2,4-6,8,10H,3,7,9,11-12H2,1H3,(H,20,22) |
| InChIKey | IWEHDKRRUSEHCK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|