C17H21ClN2O4S2 — CID 3154152
2-(4-chloro-2-methyl-N-methylsulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 3154152) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-N-methylsulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-methyl-N-methylsulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 3154152 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-(4-chloro-2-methyl-N-methylsulfonylanilino)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1N(CC(=O)NCCSCc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-13-10-14(18)5-6-16(13)20(26(2,22)23)11-17(21)19-7-9-25-12-15-4-3-8-24-15/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,19,21) |
| InChIKey | KKDMPKIAVFZDDP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|