C19H22ClFN2O3S2 — CID 30219675
2-(3-chloro-N-methylsulfonylanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30219675) has the molecular formula C19H22ClFN2O3S2 and a molecular weight of 444.98 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30219675 |
| Molecular Formula | C19H22ClFN2O3S2 |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccccc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN2O3S2/c1-28(25,26)23(17-8-4-7-16(20)12-17)13-19(24)22-10-5-11-27-14-15-6-2-3-9-18(15)21/h2-4,6-9,12H,5,10-11,13-14H2,1H3,(H,22,24) |
| InChIKey | WDULFYOFDBOKEX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|