C19H22ClIN2O3S2 — CID 43897340
N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 43897340) has the molecular formula C19H22ClIN2O3S2 and a molecular weight of 552.89 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43897340 |
| Molecular Formula | C19H22ClIN2O3S2 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 551.98 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccccc1Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H22ClIN2O3S2/c1-28(25,26)23(17-9-7-16(21)8-10-17)13-19(24)22-11-4-12-27-14-15-5-2-3-6-18(15)20/h2-3,5-10H,4,11-14H2,1H3,(H,22,24) |
| InChIKey | QTPQLOZSDZBPOR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|