C19H23IN2O3S2 — CID 30230300
N-(3-benzylsulfanylpropyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 30230300) has the molecular formula C19H23IN2O3S2 and a molecular weight of 518.44 g/mol. Its IUPAC name is N-(3-benzylsulfanylpropyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-benzylsulfanylpropyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30230300 |
| Molecular Formula | C19H23IN2O3S2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | N-(3-benzylsulfanylpropyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccccc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H23IN2O3S2/c1-27(24,25)22(18-10-8-17(20)9-11-18)14-19(23)21-12-5-13-26-15-16-6-3-2-4-7-16/h2-4,6-11H,5,12-15H2,1H3,(H,21,23) |
| InChIKey | WEXDPXIXJMZBGJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|