C19H23BrN2O3S2 — CID 30223972
N-(3-benzylsulfanylpropyl)-2-(2-bromo-N-methylsulfonylanilino)acetamide (PubChem CID 30223972) has the molecular formula C19H23BrN2O3S2 and a molecular weight of 471.44 g/mol. Its IUPAC name is N-(3-benzylsulfanylpropyl)-2-(2-bromo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-benzylsulfanylpropyl)-2-(2-bromo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30223972 |
| Molecular Formula | C19H23BrN2O3S2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | N-(3-benzylsulfanylpropyl)-2-(2-bromo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C19H23BrN2O3S2/c1-27(24,25)22(18-11-6-5-10-17(18)20)14-19(23)21-12-7-13-26-15-16-8-3-2-4-9-16/h2-6,8-11H,7,12-15H2,1H3,(H,21,23) |
| InChIKey | FXFMAPSZPVIYHM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|