C19H21Cl3N2O3S2 — CID 30225921
N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-2-(2,3-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30225921) has the molecular formula C19H21Cl3N2O3S2 and a molecular weight of 495.88 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-2-(2,3-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-2-(2,3-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30225921 |
| Molecular Formula | C19H21Cl3N2O3S2 |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | N-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-2-(2,3-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccc(Cl)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H21Cl3N2O3S2/c1-29(26,27)24(17-5-2-4-16(21)19(17)22)12-18(25)23-10-3-11-28-13-14-6-8-15(20)9-7-14/h2,4-9H,3,10-13H2,1H3,(H,23,25) |
| InChIKey | ZHJKRFNJVDEKQR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|