C22H28ClN3O4S2 — CID 30301308
4-[[2-[3-[(4-chlorophenyl)methylsulfanyl]propylamino]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzamide (PubChem CID 30301308) has the molecular formula C22H28ClN3O4S2 and a molecular weight of 498.07 g/mol. Its IUPAC name is 4-[[2-[3-[(4-chlorophenyl)methylsulfanyl]propylamino]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[3-[(4-chlorophenyl)methylsulfanyl]propylamino]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 30301308 |
| Molecular Formula | C22H28ClN3O4S2 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-[[2-[3-[(4-chlorophenyl)methylsulfanyl]propylamino]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N(CC(=O)NCCCSCc2ccc(Cl)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H28ClN3O4S2/c1-25(2)22(28)18-7-11-20(12-8-18)26(32(3,29)30)15-21(27)24-13-4-14-31-16-17-5-9-19(23)10-6-17/h5-12H,4,13-16H2,1-3H3,(H,24,27) |
| InChIKey | LBKZEBOSJGHDCK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|