C20H21Cl2F3N2O3S2 — CID 43896104
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43896104) has the molecular formula C20H21Cl2F3N2O3S2 and a molecular weight of 529.43 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43896104 |
| Molecular Formula | C20H21Cl2F3N2O3S2 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccccc1Cl)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21Cl2F3N2O3S2/c1-32(29,30)27(15-7-8-18(22)16(11-15)20(23,24)25)12-19(28)26-9-4-10-31-13-14-5-2-3-6-17(14)21/h2-3,5-8,11H,4,9-10,12-13H2,1H3,(H,26,28) |
| InChIKey | VFCWFMREKPAYQD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|