C27H28ClF3N2O3S2 — CID 43895084
2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43895084) has the molecular formula C27H28ClF3N2O3S2 and a molecular weight of 585.11 g/mol. Its IUPAC name is 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43895084 |
| Molecular Formula | C27H28ClF3N2O3S2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCSCc2cccc(C)c2)c2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H28ClF3N2O3S2/c1-19-7-10-23(11-8-19)38(35,36)33(22-9-12-25(28)24(16-22)27(29,30)31)17-26(34)32-13-4-14-37-18-21-6-3-5-20(2)15-21/h3,5-12,15-16H,4,13-14,17-18H2,1-2H3,(H,32,34) |
| InChIKey | XDNQHFNHIUZMJM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|