C25H23ClF4N2O3S2 — CID 43893195
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide (PubChem CID 43893195) has the molecular formula C25H23ClF4N2O3S2 and a molecular weight of 575.05 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 43893195 |
| Molecular Formula | C25H23ClF4N2O3S2 |
| Molecular Weight | 575.05 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCCCSCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H23ClF4N2O3S2/c26-23-12-11-20(15-22(23)25(28,29)30)32(37(34,35)21-5-2-1-3-6-21)16-24(33)31-13-4-14-36-17-18-7-9-19(27)10-8-18/h1-3,5-12,15H,4,13-14,16-17H2,(H,31,33) |
| InChIKey | FUJLEBNQPIPDEL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.05 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|