C23H19Cl2F3N2O3S2 — CID 51343778
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide (PubChem CID 51343778) has the molecular formula C23H19Cl2F3N2O3S2 and a molecular weight of 563.45 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 51343778 |
| Molecular Formula | C23H19Cl2F3N2O3S2 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[2-(4-chlorophenyl)sulfanylethyl]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2F3N2O3S2/c24-16-6-9-18(10-7-16)34-13-12-29-22(31)15-30(35(32,33)19-4-2-1-3-5-19)17-8-11-21(25)20(14-17)23(26,27)28/h1-11,14H,12-13,15H2,(H,29,31) |
| InChIKey | CUTKJSVSUVFKFB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|