C21H24ClF3N2O3S2 — CID 30223575
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30223575) has the molecular formula C21H24ClF3N2O3S2 and a molecular weight of 509.02 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30223575 |
| Molecular Formula | C21H24ClF3N2O3S2 |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-[(3-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1cccc(CSCCCNC(=O)CN(c2ccc(Cl)c(C(F)(F)F)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H24ClF3N2O3S2/c1-15-5-3-6-16(11-15)14-31-10-4-9-26-20(28)13-27(32(2,29)30)17-7-8-19(22)18(12-17)21(23,24)25/h3,5-8,11-12H,4,9-10,13-14H2,1-2H3,(H,26,28) |
| InChIKey | FLBPLIUQAOGTFI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|