C19H19Cl2F3N2O3S — CID 30223544
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2-chlorophenyl)propyl]acetamide (PubChem CID 30223544) has the molecular formula C19H19Cl2F3N2O3S and a molecular weight of 483.34 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2-chlorophenyl)propyl]acetamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2-chlorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30223544 |
| Molecular Formula | C19H19Cl2F3N2O3S |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2-chlorophenyl)propyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCc1ccccc1Cl)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19Cl2F3N2O3S/c1-30(28,29)26(14-8-9-17(21)15(11-14)19(22,23)24)12-18(27)25-10-4-6-13-5-2-3-7-16(13)20/h2-3,5,7-9,11H,4,6,10,12H2,1H3,(H,25,27) |
| InChIKey | KKMISHSLYBKLTR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|