C20H22ClF3N2O4S — CID 30225307
2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-methoxyphenyl)propyl]acetamide (PubChem CID 30225307) has the molecular formula C20H22ClF3N2O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30225307 |
| Molecular Formula | C20H22ClF3N2O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-methoxyphenyl)propyl]acetamide |
| SMILES | COc1ccccc1CCCNC(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C20H22ClF3N2O4S/c1-30-18-8-4-3-6-14(18)7-5-11-25-19(27)13-26(31(2,28)29)17-12-15(20(22,23)24)9-10-16(17)21/h3-4,6,8-10,12H,5,7,11,13H2,1-2H3,(H,25,27) |
| InChIKey | CKLMYWFEOQDKOT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|