C20H29ClF3N3O3S — CID 43896302
2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide (PubChem CID 43896302) has the molecular formula C20H29ClF3N3O3S and a molecular weight of 483.98 g/mol. Its IUPAC name is 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 43896302 |
| Molecular Formula | C20H29ClF3N3O3S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C20H29ClF3N3O3S/c1-3-16-7-4-5-11-26(16)12-6-10-25-19(28)14-27(31(2,29)30)18-13-15(20(22,23)24)8-9-17(18)21/h8-9,13,16H,3-7,10-12,14H2,1-2H3,(H,25,28) |
| InChIKey | QGUDYXXYWWRLGI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|